C16H14FN3O3S — CID 17374314
4-[(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-2,1,3-benzoxadiazole (PubChem CID 17374314) has the molecular formula C16H14FN3O3S and a molecular weight of 347.37 g/mol. Its IUPAC name is 4-[(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-2,1,3-benzoxadiazole.
| Compound Name | 4-[(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-2,1,3-benzoxadiazole |
|---|---|
| PubChem CID | 17374314 |
| Molecular Formula | C16H14FN3O3S |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 4-[(6-fluoro-2-methyl-3,4-dihydro-2H-quinolin-1-yl)sulfonyl]-2,1,3-benzoxadiazole |
| SMILES | CC1CCc2cc(F)ccc2N1S(=O)(=O)c1cccc2nonc12 |
| InChI | InChI=1S/C16H14FN3O3S/c1-10-5-6-11-9-12(17)7-8-14(11)20(10)24(21,22)15-4-2-3-13-16(15)19-23-18-13/h2-4,7-10H,5-6H2,1H3 |
| InChIKey | ZYHLSZFZESQFHO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diazox_sulfon_A(36)', 'substructure': 'N/A'} |
|---|