C18H16BrN3O2S2 — CID 17375592
3-[(2-bromophenyl)methylsulfanylmethyl]-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 17375592) has the molecular formula C18H16BrN3O2S2 and a molecular weight of 450.38 g/mol. Its IUPAC name is 3-[(2-bromophenyl)methylsulfanylmethyl]-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[(2-bromophenyl)methylsulfanylmethyl]-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 17375592 |
| Molecular Formula | C18H16BrN3O2S2 |
| Molecular Weight | 450.38 g/mol |
| Exact Mass | 448.99 |
| IUPAC Name | 3-[(2-bromophenyl)methylsulfanylmethyl]-4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(CSCc2ccccc2Br)n1-c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C18H16BrN3O2S2/c19-14-4-2-1-3-12(14)10-26-11-17-20-21-18(25)22(17)13-5-6-15-16(9-13)24-8-7-23-15/h1-6,9H,7-8,10-11H2,(H,21,25) |
| InChIKey | NNXHVLIPBVLARE-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 52.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.38 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|