About N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(4-methylsulfonylpiperazin-1-yl)acetamide
N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(4-methylsulfonylpiperazin-1-yl)acetamide (PubChem CID 17376136) has the molecular formula C11H19N5O3S2
and a molecular weight of 333.44 g/mol. Its IUPAC name is N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(4-methylsulfonylpiperazin-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(4-methylsulfonylpiperazin-1-yl)acetamide |
| PubChem CID | 17376136 |
| Molecular Formula | C11H19N5O3S2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(4-methylsulfonylpiperazin-1-yl)acetamide |
| SMILES | CCc1nnc(NC(=O)CN2CCN(S(C)(=O)=O)CC2)s1 |
| InChI | InChI=1S/C11H19N5O3S2/c1-3-10-13-14-11(20-10)12-9(17)8-15-4-6-16(7-5-15)21(2,18)19/h3-8H2,1-2H3,(H,12,14,17) |
| InChIKey | BDJOKMIURVUISB-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(4-methylsulfonylpiperazin-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(4-methylsulfonylpiperazin-1-yl)acetamide?
The IUPAC name of N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(4-methylsulfonylpiperazin-1-yl)acetamide (CID 17376136) is N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(4-methylsulfonylpiperazin-1-yl)acetamide.
What is the SMILES notation for N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(4-methylsulfonylpiperazin-1-yl)acetamide?
The canonical SMILES for N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(4-methylsulfonylpiperazin-1-yl)acetamide is CCc1nnc(NC(=O)CN2CCN(S(C)(=O)=O)CC2)s1.
What is the InChIKey of N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(4-methylsulfonylpiperazin-1-yl)acetamide?
The InChIKey is BDJOKMIURVUISB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N5O3S2/c1-3-10-13-14-11(20-10)12-9(17)8-15-4-6-16(7-5-15)21(2,18)19/h3-8H2,1-2H3,(H,12,14,17).
What are the key properties of N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(4-methylsulfonylpiperazin-1-yl)acetamide?
N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(4-methylsulfonylpiperazin-1-yl)acetamide has a molecular weight of 333.44 g/mol, XLogP of -0.38, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-(4-methylsulfonylpiperazin-1-yl)acetamide is sourced from PubChem (CID 17376136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).