C17H15Cl2N3OS — CID 17376790
4-benzyl-3-[1-(3,4-dichlorophenoxy)ethyl]-1H-1,2,4-triazole-5-thione (PubChem CID 17376790) has the molecular formula C17H15Cl2N3OS and a molecular weight of 380.30 g/mol. Its IUPAC name is 4-benzyl-3-[1-(3,4-dichlorophenoxy)ethyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-benzyl-3-[1-(3,4-dichlorophenoxy)ethyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 17376790 |
| Molecular Formula | C17H15Cl2N3OS |
| Molecular Weight | 380.30 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | 4-benzyl-3-[1-(3,4-dichlorophenoxy)ethyl]-1H-1,2,4-triazole-5-thione |
| SMILES | CC(Oc1ccc(Cl)c(Cl)c1)c1n[nH]c(=S)n1Cc1ccccc1 |
| InChI | InChI=1S/C17H15Cl2N3OS/c1-11(23-13-7-8-14(18)15(19)9-13)16-20-21-17(24)22(16)10-12-5-3-2-4-6-12/h2-9,11H,10H2,1H3,(H,21,24) |
| InChIKey | ADNFLIIWVYGYCB-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.30 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|