C22H29NO5S — CID 17378833
6-[(6-ethyl-3-propoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 17378833) has the molecular formula C22H29NO5S and a molecular weight of 419.54 g/mol. Its IUPAC name is 6-[(6-ethyl-3-propoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[(6-ethyl-3-propoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 17378833 |
| Molecular Formula | C22H29NO5S |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 6-[(6-ethyl-3-propoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | CCCOC(=O)c1c(NC(=O)C2CC=CCC2C(=O)O)sc2c1CCC(CC)C2 |
| InChI | InChI=1S/C22H29NO5S/c1-3-11-28-22(27)18-16-10-9-13(4-2)12-17(16)29-20(18)23-19(24)14-7-5-6-8-15(14)21(25)26/h5-6,13-15H,3-4,7-12H2,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | QEOLLLPXFLTODB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_C(7)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|