C18H19N3O2S — CID 17379263
3-(4-cyclopentyloxyphenyl)-4-(furan-2-ylmethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 17379263) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is 3-(4-cyclopentyloxyphenyl)-4-(furan-2-ylmethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(4-cyclopentyloxyphenyl)-4-(furan-2-ylmethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 17379263 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 3-(4-cyclopentyloxyphenyl)-4-(furan-2-ylmethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(-c2ccc(OC3CCCC3)cc2)n1Cc1ccco1 |
| InChI | InChI=1S/C18H19N3O2S/c24-18-20-19-17(21(18)12-16-6-3-11-22-16)13-7-9-15(10-8-13)23-14-4-1-2-5-14/h3,6-11,14H,1-2,4-5,12H2,(H,20,24) |
| InChIKey | TYJCNMWVMWQLQG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_urea_H(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|