About 5-(hydroxymethyl)-5-methylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one
5-(hydroxymethyl)-5-methylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one (PubChem CID 17380042) has the molecular formula C13H15NO4
and a molecular weight of 249.27 g/mol. Its IUPAC name is 5-(hydroxymethyl)-5-methylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one.
Molecular Properties
| Compound Name | 5-(hydroxymethyl)-5-methylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one |
| PubChem CID | 17380042 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 5-(hydroxymethyl)-5-methylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one |
| SMILES | CC1(CO)COC2(OC1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C13H15NO4/c1-12(6-15)7-17-13(18-8-12)9-4-2-3-5-10(9)14-11(13)16/h2-5,15H,6-8H2,1H3,(H,14,16) |
| InChIKey | AOJLBHGUVVQKSZ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(hydroxymethyl)-5-methylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(hydroxymethyl)-5-methylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one?
The IUPAC name of 5-(hydroxymethyl)-5-methylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one (CID 17380042) is 5-(hydroxymethyl)-5-methylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one.
What is the SMILES notation for 5-(hydroxymethyl)-5-methylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one?
The canonical SMILES for 5-(hydroxymethyl)-5-methylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one is CC1(CO)COC2(OC1)C(=O)Nc1ccccc12.
What is the InChIKey of 5-(hydroxymethyl)-5-methylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one?
The InChIKey is AOJLBHGUVVQKSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO4/c1-12(6-15)7-17-13(18-8-12)9-4-2-3-5-10(9)14-11(13)16/h2-5,15H,6-8H2,1H3,(H,14,16).
What are the key properties of 5-(hydroxymethyl)-5-methylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one?
5-(hydroxymethyl)-5-methylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one has a molecular weight of 249.27 g/mol, XLogP of 0.84, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(hydroxymethyl)-5-methylspiro[1,3-dioxane-2,3'-1H-indole]-2'-one is sourced from PubChem (CID 17380042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).