C13H9Cl2N3O3S — CID 17380427
1-(3,5-dichloro-4-hydroxyphenyl)-3-(3-nitrophenyl)thiourea (PubChem CID 17380427) has the molecular formula C13H9Cl2N3O3S and a molecular weight of 358.21 g/mol. Its IUPAC name is 1-(3,5-dichloro-4-hydroxyphenyl)-3-(3-nitrophenyl)thiourea.
| Compound Name | 1-(3,5-dichloro-4-hydroxyphenyl)-3-(3-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 17380427 |
| Molecular Formula | C13H9Cl2N3O3S |
| Molecular Weight | 358.21 g/mol |
| Exact Mass | 356.97 |
| IUPAC Name | 1-(3,5-dichloro-4-hydroxyphenyl)-3-(3-nitrophenyl)thiourea |
| SMILES | O=[N+]([O-])c1cccc(NC(=S)Nc2cc(Cl)c(O)c(Cl)c2)c1 |
| InChI | InChI=1S/C13H9Cl2N3O3S/c14-10-5-8(6-11(15)12(10)19)17-13(22)16-7-2-1-3-9(4-7)18(20)21/h1-6,19H,(H2,16,17,22) |
| InChIKey | QKQDYYGSNQVPFO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 87.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.21 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|