About 4-nitro-N-[4-(4-oxo-3,1-benzoxazin-2-yl)phenyl]benzenesulfonamide
4-nitro-N-[4-(4-oxo-3,1-benzoxazin-2-yl)phenyl]benzenesulfonamide (PubChem CID 17380466) has the molecular formula C20H13N3O6S
and a molecular weight of 423.41 g/mol. Its IUPAC name is 4-nitro-N-[4-(4-oxo-3,1-benzoxazin-2-yl)phenyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-nitro-N-[4-(4-oxo-3,1-benzoxazin-2-yl)phenyl]benzenesulfonamide |
| PubChem CID | 17380466 |
| Molecular Formula | C20H13N3O6S |
| Molecular Weight | 423.41 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | 4-nitro-N-[4-(4-oxo-3,1-benzoxazin-2-yl)phenyl]benzenesulfonamide |
| SMILES | O=c1oc(-c2ccc(NS(=O)(=O)c3ccc([N+](=O)[O-])cc3)cc2)nc2ccccc12 |
| InChI | InChI=1S/C20H13N3O6S/c24-20-17-3-1-2-4-18(17)21-19(29-20)13-5-7-14(8-6-13)22-30(27,28)16-11-9-15(10-12-16)23(25)26/h1-12,22H |
| InChIKey | PENDKPWCNNYSRW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 132.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitro-N-[4-(4-oxo-3,1-benzoxazin-2-yl)phenyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitro-N-[4-(4-oxo-3,1-benzoxazin-2-yl)phenyl]benzenesulfonamide?
The IUPAC name of 4-nitro-N-[4-(4-oxo-3,1-benzoxazin-2-yl)phenyl]benzenesulfonamide (CID 17380466) is 4-nitro-N-[4-(4-oxo-3,1-benzoxazin-2-yl)phenyl]benzenesulfonamide.
What is the SMILES notation for 4-nitro-N-[4-(4-oxo-3,1-benzoxazin-2-yl)phenyl]benzenesulfonamide?
The canonical SMILES for 4-nitro-N-[4-(4-oxo-3,1-benzoxazin-2-yl)phenyl]benzenesulfonamide is O=c1oc(-c2ccc(NS(=O)(=O)c3ccc([N+](=O)[O-])cc3)cc2)nc2ccccc12.
What is the InChIKey of 4-nitro-N-[4-(4-oxo-3,1-benzoxazin-2-yl)phenyl]benzenesulfonamide?
The InChIKey is PENDKPWCNNYSRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13N3O6S/c24-20-17-3-1-2-4-18(17)21-19(29-20)13-5-7-14(8-6-13)22-30(27,28)16-11-9-15(10-12-16)23(25)26/h1-12,22H.
What are the key properties of 4-nitro-N-[4-(4-oxo-3,1-benzoxazin-2-yl)phenyl]benzenesulfonamide?
4-nitro-N-[4-(4-oxo-3,1-benzoxazin-2-yl)phenyl]benzenesulfonamide has a molecular weight of 423.41 g/mol, XLogP of 3.56, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitro-N-[4-(4-oxo-3,1-benzoxazin-2-yl)phenyl]benzenesulfonamide is sourced from PubChem (CID 17380466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).