C21H19F2N5O6 — CID 17382128
N-[3-(2,4-difluorophenoxy)-5-nitrophenyl]-4-(3,5-dimethyl-4-nitropyrazol-1-yl)butanamide (PubChem CID 17382128) has the molecular formula C21H19F2N5O6 and a molecular weight of 475.41 g/mol. Its IUPAC name is N-[3-(2,4-difluorophenoxy)-5-nitrophenyl]-4-(3,5-dimethyl-4-nitropyrazol-1-yl)butanamide.
| Compound Name | N-[3-(2,4-difluorophenoxy)-5-nitrophenyl]-4-(3,5-dimethyl-4-nitropyrazol-1-yl)butanamide |
|---|---|
| PubChem CID | 17382128 |
| Molecular Formula | C21H19F2N5O6 |
| Molecular Weight | 475.41 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | N-[3-(2,4-difluorophenoxy)-5-nitrophenyl]-4-(3,5-dimethyl-4-nitropyrazol-1-yl)butanamide |
| SMILES | Cc1nn(CCCC(=O)Nc2cc(Oc3ccc(F)cc3F)cc([N+](=O)[O-])c2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C21H19F2N5O6/c1-12-21(28(32)33)13(2)26(25-12)7-3-4-20(29)24-15-9-16(27(30)31)11-17(10-15)34-19-6-5-14(22)8-18(19)23/h5-6,8-11H,3-4,7H2,1-2H3,(H,24,29) |
| InChIKey | SSKSUVSDLMLMAG-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 142.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.41 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|