C22H32F3N3O4 — CID 17382976
methyl 2-[(4-tert-butylbenzoyl)amino]-3,3,3-trifluoro-2-(3-morpholin-4-ylpropylamino)propanoate (PubChem CID 17382976) has the molecular formula C22H32F3N3O4 and a molecular weight of 459.51 g/mol. Its IUPAC name is methyl 2-[(4-tert-butylbenzoyl)amino]-3,3,3-trifluoro-2-(3-morpholin-4-ylpropylamino)propanoate.
| Compound Name | methyl 2-[(4-tert-butylbenzoyl)amino]-3,3,3-trifluoro-2-(3-morpholin-4-ylpropylamino)propanoate |
|---|---|
| PubChem CID | 17382976 |
| Molecular Formula | C22H32F3N3O4 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | methyl 2-[(4-tert-butylbenzoyl)amino]-3,3,3-trifluoro-2-(3-morpholin-4-ylpropylamino)propanoate |
| SMILES | COC(=O)C(NCCCN1CCOCC1)(NC(=O)c1ccc(C(C)(C)C)cc1)C(F)(F)F |
| InChI | InChI=1S/C22H32F3N3O4/c1-20(2,3)17-8-6-16(7-9-17)18(29)27-21(19(30)31-4,22(23,24)25)26-10-5-11-28-12-14-32-15-13-28/h6-9,26H,5,10-15H2,1-4H3,(H,27,29) |
| InChIKey | ZCFAKVGLXSELTM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|