C18H27FN4S — CID 17383880
1-[3-(diethylamino)propyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]thiourea (PubChem CID 17383880) has the molecular formula C18H27FN4S and a molecular weight of 350.51 g/mol. Its IUPAC name is 1-[3-(diethylamino)propyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]thiourea.
| Compound Name | 1-[3-(diethylamino)propyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 17383880 |
| Molecular Formula | C18H27FN4S |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 1-[3-(diethylamino)propyl]-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]thiourea |
| SMILES | CCN(CC)CCCNC(=S)NCCc1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C18H27FN4S/c1-3-23(4-2)11-5-9-20-18(24)21-10-8-14-13-22-17-12-15(19)6-7-16(14)17/h6-7,12-13,22H,3-5,8-11H2,1-2H3,(H2,20,21,24) |
| InChIKey | QNJXXEZNXQSUIJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|