C16H14INO2S — CID 17384306
3-(4-iodophenyl)-2-(4-methoxyphenyl)-1,3-thiazolidin-4-one (PubChem CID 17384306) has the molecular formula C16H14INO2S and a molecular weight of 411.26 g/mol. Its IUPAC name is 3-(4-iodophenyl)-2-(4-methoxyphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 3-(4-iodophenyl)-2-(4-methoxyphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 17384306 |
| Molecular Formula | C16H14INO2S |
| Molecular Weight | 411.26 g/mol |
| Exact Mass | 410.98 |
| IUPAC Name | 3-(4-iodophenyl)-2-(4-methoxyphenyl)-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(C2SCC(=O)N2c2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C16H14INO2S/c1-20-14-8-2-11(3-9-14)16-18(15(19)10-21-16)13-6-4-12(17)5-7-13/h2-9,16H,10H2,1H3 |
| InChIKey | UYPWBWLCVKMYNS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.26 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|