C23H28N2O8 — CID 17385004
(3,4-dimethoxyphenyl)-[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]methanone;oxalic acid (PubChem CID 17385004) has the molecular formula C23H28N2O8 and a molecular weight of 460.48 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)-[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]methanone;oxalic acid.
| Compound Name | (3,4-dimethoxyphenyl)-[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]methanone;oxalic acid |
|---|---|
| PubChem CID | 17385004 |
| Molecular Formula | C23H28N2O8 |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | (3,4-dimethoxyphenyl)-[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]methanone;oxalic acid |
| SMILES | COc1ccccc1CN1CCN(C(=O)c2ccc(OC)c(OC)c2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H26N2O4.C2H2O4/c1-25-18-7-5-4-6-17(18)15-22-10-12-23(13-11-22)21(24)16-8-9-19(26-2)20(14-16)27-3;3-1(4)2(5)6/h4-9,14H,10-13,15H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | CTCDCTXDQOUZDZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|