About 2-[(2,6-dichlorophenyl)methyl]isoquinolin-2-ium bromide
2-[(2,6-dichlorophenyl)methyl]isoquinolin-2-ium bromide (PubChem CID 17385245) has the molecular formula C16H12BrCl2N
and a molecular weight of 369.09 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methyl]isoquinolin-2-ium bromide.
Molecular Properties
| Compound Name | 2-[(2,6-dichlorophenyl)methyl]isoquinolin-2-ium bromide |
| PubChem CID | 17385245 |
| Molecular Formula | C16H12BrCl2N |
| Molecular Weight | 369.09 g/mol |
| Exact Mass | 366.95 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methyl]isoquinolin-2-ium bromide |
| SMILES | Clc1cccc(Cl)c1C[n+]1ccc2ccccc2c1.[Br-] |
| InChI | InChI=1S/C16H12Cl2N.BrH/c17-15-6-3-7-16(18)14(15)11-19-9-8-12-4-1-2-5-13(12)10-19;/h1-10H,11H2;1H/q+1;/p-1 |
| InChIKey | XAOGKZGCLNUKPC-UHFFFAOYSA-M |
| XLogP | 1.49 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.09 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2,6-dichlorophenyl)methyl]isoquinolin-2-ium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,6-dichlorophenyl)methyl]isoquinolin-2-ium bromide?
The IUPAC name of 2-[(2,6-dichlorophenyl)methyl]isoquinolin-2-ium bromide (CID 17385245) is 2-[(2,6-dichlorophenyl)methyl]isoquinolin-2-ium bromide.
What is the SMILES notation for 2-[(2,6-dichlorophenyl)methyl]isoquinolin-2-ium bromide?
The canonical SMILES for 2-[(2,6-dichlorophenyl)methyl]isoquinolin-2-ium bromide is Clc1cccc(Cl)c1C[n+]1ccc2ccccc2c1.[Br-].
What is the InChIKey of 2-[(2,6-dichlorophenyl)methyl]isoquinolin-2-ium bromide?
The InChIKey is XAOGKZGCLNUKPC-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H12Cl2N.BrH/c17-15-6-3-7-16(18)14(15)11-19-9-8-12-4-1-2-5-13(12)10-19;/h1-10H,11H2;1H/q+1;/p-1.
What are the key properties of 2-[(2,6-dichlorophenyl)methyl]isoquinolin-2-ium bromide?
2-[(2,6-dichlorophenyl)methyl]isoquinolin-2-ium bromide has a molecular weight of 369.09 g/mol, XLogP of 1.49, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,6-dichlorophenyl)methyl]isoquinolin-2-ium bromide is sourced from PubChem (CID 17385245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).