C10H15BrClNO — CID 17385872
2-(4-bromo-2,6-dimethylphenoxy)ethanamine;hydrochloride (PubChem CID 17385872) has the molecular formula C10H15BrClNO and a molecular weight of 280.59 g/mol. Its IUPAC name is 2-(4-bromo-2,6-dimethylphenoxy)ethanamine;hydrochloride.
| Compound Name | 2-(4-bromo-2,6-dimethylphenoxy)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17385872 |
| Molecular Formula | C10H15BrClNO |
| Molecular Weight | 280.59 g/mol |
| Exact Mass | 279.00 |
| IUPAC Name | 2-(4-bromo-2,6-dimethylphenoxy)ethanamine;hydrochloride |
| SMILES | Cc1cc(Br)cc(C)c1OCCN.Cl |
| InChI | InChI=1S/C10H14BrNO.ClH/c1-7-5-9(11)6-8(2)10(7)13-4-3-12;/h5-6H,3-4,12H2,1-2H3;1H |
| InChIKey | ZXJMNSGOXYCXSN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.59 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |