About 2,2-bis(prop-2-enyl)piperidine;hydrochloride
2,2-bis(prop-2-enyl)piperidine;hydrochloride (PubChem CID 17386044) has the molecular formula C11H20ClN
and a molecular weight of 201.74 g/mol. Its IUPAC name is 2,2-bis(prop-2-enyl)piperidine;hydrochloride.
Molecular Properties
| Compound Name | 2,2-bis(prop-2-enyl)piperidine;hydrochloride |
| PubChem CID | 17386044 |
| Molecular Formula | C11H20ClN |
| Molecular Weight | 201.74 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 2,2-bis(prop-2-enyl)piperidine;hydrochloride |
| SMILES | C=CCC1(CC=C)CCCCN1.Cl |
| InChI | InChI=1S/C11H19N.ClH/c1-3-7-11(8-4-2)9-5-6-10-12-11;/h3-4,12H,1-2,5-10H2;1H |
| InChIKey | RCBADOSIQUICOW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.74 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,2-bis(prop-2-enyl)piperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis(prop-2-enyl)piperidine;hydrochloride?
The IUPAC name of 2,2-bis(prop-2-enyl)piperidine;hydrochloride (CID 17386044) is 2,2-bis(prop-2-enyl)piperidine;hydrochloride.
What is the SMILES notation for 2,2-bis(prop-2-enyl)piperidine;hydrochloride?
The canonical SMILES for 2,2-bis(prop-2-enyl)piperidine;hydrochloride is C=CCC1(CC=C)CCCCN1.Cl.
What is the InChIKey of 2,2-bis(prop-2-enyl)piperidine;hydrochloride?
The InChIKey is RCBADOSIQUICOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N.ClH/c1-3-7-11(8-4-2)9-5-6-10-12-11;/h3-4,12H,1-2,5-10H2;1H.
What are the key properties of 2,2-bis(prop-2-enyl)piperidine;hydrochloride?
2,2-bis(prop-2-enyl)piperidine;hydrochloride has a molecular weight of 201.74 g/mol, XLogP of 3.07, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(prop-2-enyl)piperidine;hydrochloride is sourced from PubChem (CID 17386044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).