C24H29NOS2 — CID 17386058
2-[[2-(4-methoxyphenyl)-4-phenyl-4,4a,5,6,7,8-hexahydrothiochromen-8a-yl]sulfanyl]ethanamine (PubChem CID 17386058) has the molecular formula C24H29NOS2 and a molecular weight of 411.64 g/mol. Its IUPAC name is 2-[[2-(4-methoxyphenyl)-4-phenyl-4,4a,5,6,7,8-hexahydrothiochromen-8a-yl]sulfanyl]ethanamine.
| Compound Name | 2-[[2-(4-methoxyphenyl)-4-phenyl-4,4a,5,6,7,8-hexahydrothiochromen-8a-yl]sulfanyl]ethanamine |
|---|---|
| PubChem CID | 17386058 |
| Molecular Formula | C24H29NOS2 |
| Molecular Weight | 411.64 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 2-[[2-(4-methoxyphenyl)-4-phenyl-4,4a,5,6,7,8-hexahydrothiochromen-8a-yl]sulfanyl]ethanamine |
| SMILES | COc1ccc(C2=CC(c3ccccc3)C3CCCCC3(SCCN)S2)cc1 |
| InChI | InChI=1S/C24H29NOS2/c1-26-20-12-10-19(11-13-20)23-17-21(18-7-3-2-4-8-18)22-9-5-6-14-24(22,28-23)27-16-15-25/h2-4,7-8,10-13,17,21-22H,5-6,9,14-16,25H2,1H3 |
| InChIKey | INNLMFNFLLUNFE-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.64 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |