C13H14N4O5 — CID 17386597
4-nitro-N'-(2-oxo-2-pyrrolidin-1-ylacetyl)benzohydrazide (PubChem CID 17386597) has the molecular formula C13H14N4O5 and a molecular weight of 306.28 g/mol. Its IUPAC name is 4-nitro-N'-(2-oxo-2-pyrrolidin-1-ylacetyl)benzohydrazide.
| Compound Name | 4-nitro-N'-(2-oxo-2-pyrrolidin-1-ylacetyl)benzohydrazide |
|---|---|
| PubChem CID | 17386597 |
| Molecular Formula | C13H14N4O5 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 4-nitro-N'-(2-oxo-2-pyrrolidin-1-ylacetyl)benzohydrazide |
| SMILES | O=C(NNC(=O)c1ccc([N+](=O)[O-])cc1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C13H14N4O5/c18-11(9-3-5-10(6-4-9)17(21)22)14-15-12(19)13(20)16-7-1-2-8-16/h3-6H,1-2,7-8H2,(H,14,18)(H,15,19) |
| InChIKey | HHNZCSKSWRHZAH-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|