C15H26N+ — CID 17386630
2,3,4,5,6-pentadeuterio-1,1-dimethyl-2,6-bis(2-methylprop-2-enyl)-3H-pyridin-1-ium (PubChem CID 17386630) has the molecular formula C15H26N+ and a molecular weight of 225.41 g/mol. Its IUPAC name is 2,3,4,5,6-pentadeuterio-1,1-dimethyl-2,6-bis(2-methylprop-2-enyl)-3H-pyridin-1-ium.
| Compound Name | 2,3,4,5,6-pentadeuterio-1,1-dimethyl-2,6-bis(2-methylprop-2-enyl)-3H-pyridin-1-ium |
|---|---|
| PubChem CID | 17386630 |
| Molecular Formula | C15H26N+ |
| Molecular Weight | 225.41 g/mol |
| Exact Mass | 225.24 |
| IUPAC Name | 2,3,4,5,6-pentadeuterio-1,1-dimethyl-2,6-bis(2-methylprop-2-enyl)-3H-pyridin-1-ium |
| SMILES | [2H]C1=C([2H])C([2H])(CC(=C)C)[N+](C)(C)C([2H])(CC(=C)C)C1[2H] |
| InChI | InChI=1S/C15H26N/c1-12(2)10-14-8-7-9-15(11-13(3)4)16(14,5)6/h7-8,14-15H,1,3,9-11H2,2,4-6H3/q+1/i7D,8D,9D,14D,15D |
| InChIKey | HEUZJFVZDYSCHY-CFPNEJFESA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|