C13H14N8O3 — CID 17386808
N-butyl-6-(4-nitropyrazol-1-yl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 17386808) has the molecular formula C13H14N8O3 and a molecular weight of 330.31 g/mol. Its IUPAC name is N-butyl-6-(4-nitropyrazol-1-yl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | N-butyl-6-(4-nitropyrazol-1-yl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 17386808 |
| Molecular Formula | C13H14N8O3 |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | N-butyl-6-(4-nitropyrazol-1-yl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | CCCCNC(=O)c1nc2ncc(-n3cc([N+](=O)[O-])cn3)cn2n1 |
| InChI | InChI=1S/C13H14N8O3/c1-2-3-4-14-12(22)11-17-13-15-5-9(7-20(13)18-11)19-8-10(6-16-19)21(23)24/h5-8H,2-4H2,1H3,(H,14,22) |
| InChIKey | RJKUUIDWWSLNFD-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 133.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|