C11H11NO2 — CID 17387198
(E,5E)-5-hydroxyimino-4-phenylpent-3-en-2-one (PubChem CID 17387198) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is (E,5E)-5-hydroxyimino-4-phenylpent-3-en-2-one.
| Compound Name | (E,5E)-5-hydroxyimino-4-phenylpent-3-en-2-one |
|---|---|
| PubChem CID | 17387198 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | (E,5E)-5-hydroxyimino-4-phenylpent-3-en-2-one |
| SMILES | CC(=O)/C=C(/C=N/O)c1ccccc1 |
| InChI | InChI=1S/C11H11NO2/c1-9(13)7-11(8-12-14)10-5-3-2-4-6-10/h2-8,14H,1H3/b11-7-,12-8+ |
| InChIKey | FZHNVHXFXNYZMP-NTLHZVPKSA-N |
| XLogP | 2.12 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|