About 6,8-dichloro-2-(2,4-dichlorophenyl)iminochromene-3-carboxamide
6,8-dichloro-2-(2,4-dichlorophenyl)iminochromene-3-carboxamide (PubChem CID 17387305) has the molecular formula C16H8Cl4N2O2
and a molecular weight of 402.06 g/mol. Its IUPAC name is 6,8-dichloro-2-(2,4-dichlorophenyl)iminochromene-3-carboxamide.
Molecular Properties
| Compound Name | 6,8-dichloro-2-(2,4-dichlorophenyl)iminochromene-3-carboxamide |
| PubChem CID | 17387305 |
| Molecular Formula | C16H8Cl4N2O2 |
| Molecular Weight | 402.06 g/mol |
| Exact Mass | 399.93 |
| IUPAC Name | 6,8-dichloro-2-(2,4-dichlorophenyl)iminochromene-3-carboxamide |
| SMILES | NC(=O)c1cc2cc(Cl)cc(Cl)c2o/c1=N\c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H8Cl4N2O2/c17-8-1-2-13(11(19)5-8)22-16-10(15(21)23)4-7-3-9(18)6-12(20)14(7)24-16/h1-6H,(H2,21,23)/b22-16- |
| InChIKey | LTNVEODZGGVXCG-JWGURIENSA-N |
| XLogP | 5.38 |
| TPSA | 68.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.06 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,8-dichloro-2-(2,4-dichlorophenyl)iminochromene-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dichloro-2-(2,4-dichlorophenyl)iminochromene-3-carboxamide?
The IUPAC name of 6,8-dichloro-2-(2,4-dichlorophenyl)iminochromene-3-carboxamide (CID 17387305) is 6,8-dichloro-2-(2,4-dichlorophenyl)iminochromene-3-carboxamide.
What is the SMILES notation for 6,8-dichloro-2-(2,4-dichlorophenyl)iminochromene-3-carboxamide?
The canonical SMILES for 6,8-dichloro-2-(2,4-dichlorophenyl)iminochromene-3-carboxamide is NC(=O)c1cc2cc(Cl)cc(Cl)c2o/c1=N\c1ccc(Cl)cc1Cl.
What is the InChIKey of 6,8-dichloro-2-(2,4-dichlorophenyl)iminochromene-3-carboxamide?
The InChIKey is LTNVEODZGGVXCG-JWGURIENSA-N. The full InChI is InChI=1S/C16H8Cl4N2O2/c17-8-1-2-13(11(19)5-8)22-16-10(15(21)23)4-7-3-9(18)6-12(20)14(7)24-16/h1-6H,(H2,21,23)/b22-16-.
What are the key properties of 6,8-dichloro-2-(2,4-dichlorophenyl)iminochromene-3-carboxamide?
6,8-dichloro-2-(2,4-dichlorophenyl)iminochromene-3-carboxamide has a molecular weight of 402.06 g/mol, XLogP of 5.38, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dichloro-2-(2,4-dichlorophenyl)iminochromene-3-carboxamide is sourced from PubChem (CID 17387305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).