C11H16F6N2O — CID 17387309
1-cyclohexyl-3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)urea (PubChem CID 17387309) has the molecular formula C11H16F6N2O and a molecular weight of 306.25 g/mol. Its IUPAC name is 1-cyclohexyl-3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)urea.
| Compound Name | 1-cyclohexyl-3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)urea |
|---|---|
| PubChem CID | 17387309 |
| Molecular Formula | C11H16F6N2O |
| Molecular Weight | 306.25 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1-cyclohexyl-3-(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)urea |
| SMILES | CC(NC(=O)NC1CCCCC1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H16F6N2O/c1-9(10(12,13)14,11(15,16)17)19-8(20)18-7-5-3-2-4-6-7/h7H,2-6H2,1H3,(H2,18,19,20) |
| InChIKey | DHHPOIVAAJQFAL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.25 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |