C17H14N2O2S — CID 17387879
methyl 4-[(E)-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)iminomethyl]benzoate (PubChem CID 17387879) has the molecular formula C17H14N2O2S and a molecular weight of 310.38 g/mol. Its IUPAC name is methyl 4-[(E)-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)iminomethyl]benzoate.
| Compound Name | methyl 4-[(E)-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)iminomethyl]benzoate |
|---|---|
| PubChem CID | 17387879 |
| Molecular Formula | C17H14N2O2S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | methyl 4-[(E)-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)iminomethyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=N/c2sc3c(c2C#N)CCC3)cc1 |
| InChI | InChI=1S/C17H14N2O2S/c1-21-17(20)12-7-5-11(6-8-12)10-19-16-14(9-18)13-3-2-4-15(13)22-16/h5-8,10H,2-4H2,1H3/b19-10+ |
| InChIKey | IZMGRWLGTZIBRR-VXLYETTFSA-N |
| XLogP | 3.65 |
| TPSA | 62.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|