About methyl (E)-2-cyano-3-[2,5-dimethyl-3-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]phenyl]prop-2-enoate
methyl (E)-2-cyano-3-[2,5-dimethyl-3-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]phenyl]prop-2-enoate (PubChem CID 17388295) has the molecular formula C18H16F3N3O2
and a molecular weight of 363.34 g/mol. Its IUPAC name is methyl (E)-2-cyano-3-[2,5-dimethyl-3-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]phenyl]prop-2-enoate.
Molecular Properties
| Compound Name | methyl (E)-2-cyano-3-[2,5-dimethyl-3-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]phenyl]prop-2-enoate |
| PubChem CID | 17388295 |
| Molecular Formula | C18H16F3N3O2 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | methyl (E)-2-cyano-3-[2,5-dimethyl-3-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C(C#N)=C/c1cc(C)cc(Cn2ccc(C(F)(F)F)n2)c1C |
| InChI | InChI=1S/C18H16F3N3O2/c1-11-6-13(8-14(9-22)17(25)26-3)12(2)15(7-11)10-24-5-4-16(23-24)18(19,20)21/h4-8H,10H2,1-3H3/b14-8+ |
| InChIKey | JDAOFHAYZLSMFU-RIYZIHGNSA-N |
| XLogP | 3.65 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-2-cyano-3-[2,5-dimethyl-3-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]phenyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-2-cyano-3-[2,5-dimethyl-3-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]phenyl]prop-2-enoate?
The IUPAC name of methyl (E)-2-cyano-3-[2,5-dimethyl-3-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]phenyl]prop-2-enoate (CID 17388295) is methyl (E)-2-cyano-3-[2,5-dimethyl-3-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]phenyl]prop-2-enoate.
What is the SMILES notation for methyl (E)-2-cyano-3-[2,5-dimethyl-3-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]phenyl]prop-2-enoate?
The canonical SMILES for methyl (E)-2-cyano-3-[2,5-dimethyl-3-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]phenyl]prop-2-enoate is COC(=O)/C(C#N)=C/c1cc(C)cc(Cn2ccc(C(F)(F)F)n2)c1C.
What is the InChIKey of methyl (E)-2-cyano-3-[2,5-dimethyl-3-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]phenyl]prop-2-enoate?
The InChIKey is JDAOFHAYZLSMFU-RIYZIHGNSA-N. The full InChI is InChI=1S/C18H16F3N3O2/c1-11-6-13(8-14(9-22)17(25)26-3)12(2)15(7-11)10-24-5-4-16(23-24)18(19,20)21/h4-8H,10H2,1-3H3/b14-8+.
What are the key properties of methyl (E)-2-cyano-3-[2,5-dimethyl-3-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]phenyl]prop-2-enoate?
methyl (E)-2-cyano-3-[2,5-dimethyl-3-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]phenyl]prop-2-enoate has a molecular weight of 363.34 g/mol, XLogP of 3.65, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-2-cyano-3-[2,5-dimethyl-3-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]phenyl]prop-2-enoate is sourced from PubChem (CID 17388295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).