About 2,3-dimethylthieno[2,3-g][1,2]benzothiazol-2-ium
2,3-dimethylthieno[2,3-g][1,2]benzothiazol-2-ium (PubChem CID 17388521) has the molecular formula C11H10NS2+
and a molecular weight of 220.34 g/mol. Its IUPAC name is 2,3-dimethylthieno[2,3-g][1,2]benzothiazol-2-ium.
Molecular Properties
| Compound Name | 2,3-dimethylthieno[2,3-g][1,2]benzothiazol-2-ium |
| PubChem CID | 17388521 |
| Molecular Formula | C11H10NS2+ |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | 2,3-dimethylthieno[2,3-g][1,2]benzothiazol-2-ium |
| SMILES | Cc1c2ccc3sccc3c2s[n+]1C |
| InChI | InChI=1S/C11H10NS2/c1-7-8-3-4-10-9(5-6-13-10)11(8)14-12(7)2/h3-6H,1-2H3/q+1 |
| InChIKey | PPBAPEFVUJTWQX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethylthieno[2,3-g][1,2]benzothiazol-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylthieno[2,3-g][1,2]benzothiazol-2-ium?
The IUPAC name of 2,3-dimethylthieno[2,3-g][1,2]benzothiazol-2-ium (CID 17388521) is 2,3-dimethylthieno[2,3-g][1,2]benzothiazol-2-ium.
What is the SMILES notation for 2,3-dimethylthieno[2,3-g][1,2]benzothiazol-2-ium?
The canonical SMILES for 2,3-dimethylthieno[2,3-g][1,2]benzothiazol-2-ium is Cc1c2ccc3sccc3c2s[n+]1C.
What is the InChIKey of 2,3-dimethylthieno[2,3-g][1,2]benzothiazol-2-ium?
The InChIKey is PPBAPEFVUJTWQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10NS2/c1-7-8-3-4-10-9(5-6-13-10)11(8)14-12(7)2/h3-6H,1-2H3/q+1.
What are the key properties of 2,3-dimethylthieno[2,3-g][1,2]benzothiazol-2-ium?
2,3-dimethylthieno[2,3-g][1,2]benzothiazol-2-ium has a molecular weight of 220.34 g/mol, XLogP of 3.25, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylthieno[2,3-g][1,2]benzothiazol-2-ium is sourced from PubChem (CID 17388521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).