About 2-(diethylamino)ethyl 2-phenylacetate
2-(diethylamino)ethyl 2-phenylacetate (PubChem CID 17389) has the molecular formula C14H21NO2
and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 2-phenylacetate.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl 2-phenylacetate |
| PubChem CID | 17389 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 2-(diethylamino)ethyl 2-phenylacetate |
| SMILES | CCN(CC)CCOC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C14H21NO2/c1-3-15(4-2)10-11-17-14(16)12-13-8-6-5-7-9-13/h5-9H,3-4,10-12H2,1-2H3 |
| InChIKey | RWVYTYAOLUZVRV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(diethylamino)ethyl 2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl 2-phenylacetate?
The IUPAC name of 2-(diethylamino)ethyl 2-phenylacetate (CID 17389) is 2-(diethylamino)ethyl 2-phenylacetate.
What is the SMILES notation for 2-(diethylamino)ethyl 2-phenylacetate?
The canonical SMILES for 2-(diethylamino)ethyl 2-phenylacetate is CCN(CC)CCOC(=O)Cc1ccccc1.
What is the InChIKey of 2-(diethylamino)ethyl 2-phenylacetate?
The InChIKey is RWVYTYAOLUZVRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO2/c1-3-15(4-2)10-11-17-14(16)12-13-8-6-5-7-9-13/h5-9H,3-4,10-12H2,1-2H3.
What are the key properties of 2-(diethylamino)ethyl 2-phenylacetate?
2-(diethylamino)ethyl 2-phenylacetate has a molecular weight of 235.33 g/mol, XLogP of 2.11, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl 2-phenylacetate is sourced from PubChem (CID 17389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).