About 1-[[(Z)-N'-nitrocarbamimidoyl]amino]-3-[[(E)-N'-nitrocarbamimidoyl]amino]urea
1-[[(Z)-N'-nitrocarbamimidoyl]amino]-3-[[(E)-N'-nitrocarbamimidoyl]amino]urea (PubChem CID 17389492) has the molecular formula C3H8N10O5
and a molecular weight of 264.16 g/mol. Its IUPAC name is 1-[[(Z)-N'-nitrocarbamimidoyl]amino]-3-[[(E)-N'-nitrocarbamimidoyl]amino]urea.
Molecular Properties
| Compound Name | 1-[[(Z)-N'-nitrocarbamimidoyl]amino]-3-[[(E)-N'-nitrocarbamimidoyl]amino]urea |
| PubChem CID | 17389492 |
| Molecular Formula | C3H8N10O5 |
| Molecular Weight | 264.16 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 1-[[(Z)-N'-nitrocarbamimidoyl]amino]-3-[[(E)-N'-nitrocarbamimidoyl]amino]urea |
| SMILES | N/C(=N/[N+](=O)[O-])NNC(=O)NN/C(N)=N/[N+](=O)[O-] |
| InChI | InChI=1S/C3H8N10O5/c4-1(10-12(15)16)6-8-3(14)9-7-2(5)11-13(17)18/h(H3,4,6,10)(H3,5,7,11)(H2,8,9,14) |
| InChIKey | GRZDMVUAPNNBGC-UHFFFAOYSA-N |
| XLogP | -3.69 |
| TPSA | 228.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.16 |
| LogP ≤ 5 | -3.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[[(Z)-N'-nitrocarbamimidoyl]amino]-3-[[(E)-N'-nitrocarbamimidoyl]amino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(Z)-N'-nitrocarbamimidoyl]amino]-3-[[(E)-N'-nitrocarbamimidoyl]amino]urea?
The IUPAC name of 1-[[(Z)-N'-nitrocarbamimidoyl]amino]-3-[[(E)-N'-nitrocarbamimidoyl]amino]urea (CID 17389492) is 1-[[(Z)-N'-nitrocarbamimidoyl]amino]-3-[[(E)-N'-nitrocarbamimidoyl]amino]urea.
What is the SMILES notation for 1-[[(Z)-N'-nitrocarbamimidoyl]amino]-3-[[(E)-N'-nitrocarbamimidoyl]amino]urea?
The canonical SMILES for 1-[[(Z)-N'-nitrocarbamimidoyl]amino]-3-[[(E)-N'-nitrocarbamimidoyl]amino]urea is N/C(=N/[N+](=O)[O-])NNC(=O)NN/C(N)=N/[N+](=O)[O-].
What is the InChIKey of 1-[[(Z)-N'-nitrocarbamimidoyl]amino]-3-[[(E)-N'-nitrocarbamimidoyl]amino]urea?
The InChIKey is GRZDMVUAPNNBGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N10O5/c4-1(10-12(15)16)6-8-3(14)9-7-2(5)11-13(17)18/h(H3,4,6,10)(H3,5,7,11)(H2,8,9,14).
What are the key properties of 1-[[(Z)-N'-nitrocarbamimidoyl]amino]-3-[[(E)-N'-nitrocarbamimidoyl]amino]urea?
1-[[(Z)-N'-nitrocarbamimidoyl]amino]-3-[[(E)-N'-nitrocarbamimidoyl]amino]urea has a molecular weight of 264.16 g/mol, XLogP of -3.69, 2 rotatable bonds, 6 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(Z)-N'-nitrocarbamimidoyl]amino]-3-[[(E)-N'-nitrocarbamimidoyl]amino]urea is sourced from PubChem (CID 17389492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).