About 4-(2-aminoethyl)-5-phenyl-1,2-dihydropyrazol-3-one;oxalic acid
4-(2-aminoethyl)-5-phenyl-1,2-dihydropyrazol-3-one;oxalic acid (PubChem CID 17389561) has the molecular formula C13H15N3O5
and a molecular weight of 293.28 g/mol. Its IUPAC name is 4-(2-aminoethyl)-5-phenyl-1,2-dihydropyrazol-3-one;oxalic acid.
Molecular Properties
| Compound Name | 4-(2-aminoethyl)-5-phenyl-1,2-dihydropyrazol-3-one;oxalic acid |
| PubChem CID | 17389561 |
| Molecular Formula | C13H15N3O5 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 4-(2-aminoethyl)-5-phenyl-1,2-dihydropyrazol-3-one;oxalic acid |
| SMILES | NCCc1c(-c2ccccc2)[nH][nH]c1=O.O=C(O)C(=O)O |
| InChI | InChI=1S/C11H13N3O.C2H2O4/c12-7-6-9-10(13-14-11(9)15)8-4-2-1-3-5-8;3-1(4)2(5)6/h1-5H,6-7,12H2,(H2,13,14,15);(H,3,4)(H,5,6) |
| InChIKey | PNTFFRGATDTVBI-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 149.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-aminoethyl)-5-phenyl-1,2-dihydropyrazol-3-one;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminoethyl)-5-phenyl-1,2-dihydropyrazol-3-one;oxalic acid?
The IUPAC name of 4-(2-aminoethyl)-5-phenyl-1,2-dihydropyrazol-3-one;oxalic acid (CID 17389561) is 4-(2-aminoethyl)-5-phenyl-1,2-dihydropyrazol-3-one;oxalic acid.
What is the SMILES notation for 4-(2-aminoethyl)-5-phenyl-1,2-dihydropyrazol-3-one;oxalic acid?
The canonical SMILES for 4-(2-aminoethyl)-5-phenyl-1,2-dihydropyrazol-3-one;oxalic acid is NCCc1c(-c2ccccc2)[nH][nH]c1=O.O=C(O)C(=O)O.
What is the InChIKey of 4-(2-aminoethyl)-5-phenyl-1,2-dihydropyrazol-3-one;oxalic acid?
The InChIKey is PNTFFRGATDTVBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O.C2H2O4/c12-7-6-9-10(13-14-11(9)15)8-4-2-1-3-5-8;3-1(4)2(5)6/h1-5H,6-7,12H2,(H2,13,14,15);(H,3,4)(H,5,6).
What are the key properties of 4-(2-aminoethyl)-5-phenyl-1,2-dihydropyrazol-3-one;oxalic acid?
4-(2-aminoethyl)-5-phenyl-1,2-dihydropyrazol-3-one;oxalic acid has a molecular weight of 293.28 g/mol, XLogP of 0.03, 3 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminoethyl)-5-phenyl-1,2-dihydropyrazol-3-one;oxalic acid is sourced from PubChem (CID 17389561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).