About 1,1,1-trifluoro-4,4-bis(phenylsulfanyl)but-3-en-2-one
1,1,1-trifluoro-4,4-bis(phenylsulfanyl)but-3-en-2-one (PubChem CID 17389991) has the molecular formula C16H11F3OS2
and a molecular weight of 340.39 g/mol. Its IUPAC name is 1,1,1-trifluoro-4,4-bis(phenylsulfanyl)but-3-en-2-one.
Molecular Properties
| Compound Name | 1,1,1-trifluoro-4,4-bis(phenylsulfanyl)but-3-en-2-one |
| PubChem CID | 17389991 |
| Molecular Formula | C16H11F3OS2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 1,1,1-trifluoro-4,4-bis(phenylsulfanyl)but-3-en-2-one |
| SMILES | O=C(C=C(Sc1ccccc1)Sc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H11F3OS2/c17-16(18,19)14(20)11-15(21-12-7-3-1-4-8-12)22-13-9-5-2-6-10-13/h1-11H |
| InChIKey | PDCMALAZNDNDJP-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1,1,1-trifluoro-4,4-bis(phenylsulfanyl)but-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,1-trifluoro-4,4-bis(phenylsulfanyl)but-3-en-2-one?
The IUPAC name of 1,1,1-trifluoro-4,4-bis(phenylsulfanyl)but-3-en-2-one (CID 17389991) is 1,1,1-trifluoro-4,4-bis(phenylsulfanyl)but-3-en-2-one.
What is the SMILES notation for 1,1,1-trifluoro-4,4-bis(phenylsulfanyl)but-3-en-2-one?
The canonical SMILES for 1,1,1-trifluoro-4,4-bis(phenylsulfanyl)but-3-en-2-one is O=C(C=C(Sc1ccccc1)Sc1ccccc1)C(F)(F)F.
What is the InChIKey of 1,1,1-trifluoro-4,4-bis(phenylsulfanyl)but-3-en-2-one?
The InChIKey is PDCMALAZNDNDJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11F3OS2/c17-16(18,19)14(20)11-15(21-12-7-3-1-4-8-12)22-13-9-5-2-6-10-13/h1-11H.
What are the key properties of 1,1,1-trifluoro-4,4-bis(phenylsulfanyl)but-3-en-2-one?
1,1,1-trifluoro-4,4-bis(phenylsulfanyl)but-3-en-2-one has a molecular weight of 340.39 g/mol, XLogP of 5.54, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,1-trifluoro-4,4-bis(phenylsulfanyl)but-3-en-2-one is sourced from PubChem (CID 17389991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).