About 2-(diethylamino)ethyl benzoate
2-(diethylamino)ethyl benzoate (PubChem CID 17390) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-(diethylamino)ethyl benzoate.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl benzoate |
| PubChem CID | 17390 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 2-(diethylamino)ethyl benzoate |
| SMILES | CCN(CC)CCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H19NO2/c1-3-14(4-2)10-11-16-13(15)12-8-6-5-7-9-12/h5-9H,3-4,10-11H2,1-2H3 |
| InChIKey | GEVPHAFTDXTZHY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(diethylamino)ethyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl benzoate?
The IUPAC name of 2-(diethylamino)ethyl benzoate (CID 17390) is 2-(diethylamino)ethyl benzoate.
What is the SMILES notation for 2-(diethylamino)ethyl benzoate?
The canonical SMILES for 2-(diethylamino)ethyl benzoate is CCN(CC)CCOC(=O)c1ccccc1.
What is the InChIKey of 2-(diethylamino)ethyl benzoate?
The InChIKey is GEVPHAFTDXTZHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2/c1-3-14(4-2)10-11-16-13(15)12-8-6-5-7-9-12/h5-9H,3-4,10-11H2,1-2H3.
What are the key properties of 2-(diethylamino)ethyl benzoate?
2-(diethylamino)ethyl benzoate has a molecular weight of 221.30 g/mol, XLogP of 2.19, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl benzoate is sourced from PubChem (CID 17390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).