About 4-(2-aminoethyl)-5-(methoxymethyl)-1,2-dihydropyrazol-3-one
4-(2-aminoethyl)-5-(methoxymethyl)-1,2-dihydropyrazol-3-one (PubChem CID 17390072) has the molecular formula C7H13N3O2
and a molecular weight of 171.20 g/mol. Its IUPAC name is 4-(2-aminoethyl)-5-(methoxymethyl)-1,2-dihydropyrazol-3-one.
Molecular Properties
| Compound Name | 4-(2-aminoethyl)-5-(methoxymethyl)-1,2-dihydropyrazol-3-one |
| PubChem CID | 17390072 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 4-(2-aminoethyl)-5-(methoxymethyl)-1,2-dihydropyrazol-3-one |
| SMILES | COCc1[nH][nH]c(=O)c1CCN |
| InChI | InChI=1S/C7H13N3O2/c1-12-4-6-5(2-3-8)7(11)10-9-6/h2-4,8H2,1H3,(H2,9,10,11) |
| InChIKey | AIVXXHCTAXATSM-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-aminoethyl)-5-(methoxymethyl)-1,2-dihydropyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminoethyl)-5-(methoxymethyl)-1,2-dihydropyrazol-3-one?
The IUPAC name of 4-(2-aminoethyl)-5-(methoxymethyl)-1,2-dihydropyrazol-3-one (CID 17390072) is 4-(2-aminoethyl)-5-(methoxymethyl)-1,2-dihydropyrazol-3-one.
What is the SMILES notation for 4-(2-aminoethyl)-5-(methoxymethyl)-1,2-dihydropyrazol-3-one?
The canonical SMILES for 4-(2-aminoethyl)-5-(methoxymethyl)-1,2-dihydropyrazol-3-one is COCc1[nH][nH]c(=O)c1CCN.
What is the InChIKey of 4-(2-aminoethyl)-5-(methoxymethyl)-1,2-dihydropyrazol-3-one?
The InChIKey is AIVXXHCTAXATSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O2/c1-12-4-6-5(2-3-8)7(11)10-9-6/h2-4,8H2,1H3,(H2,9,10,11).
What are the key properties of 4-(2-aminoethyl)-5-(methoxymethyl)-1,2-dihydropyrazol-3-one?
4-(2-aminoethyl)-5-(methoxymethyl)-1,2-dihydropyrazol-3-one has a molecular weight of 171.20 g/mol, XLogP of -0.65, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminoethyl)-5-(methoxymethyl)-1,2-dihydropyrazol-3-one is sourced from PubChem (CID 17390072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).