About 2-(4-fluorophenyl)ethyl 4-methylbenzenesulfonate
2-(4-fluorophenyl)ethyl 4-methylbenzenesulfonate (PubChem CID 17390106) has the molecular formula C15H15FO3S
and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-(4-fluorophenyl)ethyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | 2-(4-fluorophenyl)ethyl 4-methylbenzenesulfonate |
| PubChem CID | 17390106 |
| Molecular Formula | C15H15FO3S |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 2-(4-fluorophenyl)ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C15H15FO3S/c1-12-2-8-15(9-3-12)20(17,18)19-11-10-13-4-6-14(16)7-5-13/h2-9H,10-11H2,1H3 |
| InChIKey | VYTFNVGKANGTGU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-fluorophenyl)ethyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenyl)ethyl 4-methylbenzenesulfonate?
The IUPAC name of 2-(4-fluorophenyl)ethyl 4-methylbenzenesulfonate (CID 17390106) is 2-(4-fluorophenyl)ethyl 4-methylbenzenesulfonate.
What is the SMILES notation for 2-(4-fluorophenyl)ethyl 4-methylbenzenesulfonate?
The canonical SMILES for 2-(4-fluorophenyl)ethyl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OCCc2ccc(F)cc2)cc1.
What is the InChIKey of 2-(4-fluorophenyl)ethyl 4-methylbenzenesulfonate?
The InChIKey is VYTFNVGKANGTGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15FO3S/c1-12-2-8-15(9-3-12)20(17,18)19-11-10-13-4-6-14(16)7-5-13/h2-9H,10-11H2,1H3.
What are the key properties of 2-(4-fluorophenyl)ethyl 4-methylbenzenesulfonate?
2-(4-fluorophenyl)ethyl 4-methylbenzenesulfonate has a molecular weight of 294.35 g/mol, XLogP of 3.08, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenyl)ethyl 4-methylbenzenesulfonate is sourced from PubChem (CID 17390106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).