C17H11F3N2O2 — CID 17390423
1-(1,3-benzoxazol-2-yl)-2,2,2-trifluoro-1-(1H-indol-3-yl)ethanol (PubChem CID 17390423) has the molecular formula C17H11F3N2O2 and a molecular weight of 332.28 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-2-yl)-2,2,2-trifluoro-1-(1H-indol-3-yl)ethanol.
| Compound Name | 1-(1,3-benzoxazol-2-yl)-2,2,2-trifluoro-1-(1H-indol-3-yl)ethanol |
|---|---|
| PubChem CID | 17390423 |
| Molecular Formula | C17H11F3N2O2 |
| Molecular Weight | 332.28 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 1-(1,3-benzoxazol-2-yl)-2,2,2-trifluoro-1-(1H-indol-3-yl)ethanol |
| SMILES | OC(c1nc2ccccc2o1)(c1c[nH]c2ccccc12)C(F)(F)F |
| InChI | InChI=1S/C17H11F3N2O2/c18-17(19,20)16(23,11-9-21-12-6-2-1-5-10(11)12)15-22-13-7-3-4-8-14(13)24-15/h1-9,21,23H |
| InChIKey | BKUMAGSGDZLWQD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.28 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |