C24H26N4O4S — CID 17390448
ethyl 6-[2-[(1Z)-buta-1,3-dienyl]sulfanylacetyl]imino-11-methyl-2-oxo-7-propyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate (PubChem CID 17390448) has the molecular formula C24H26N4O4S and a molecular weight of 466.56 g/mol. Its IUPAC name is ethyl 6-[2-[(1Z)-buta-1,3-dienyl]sulfanylacetyl]imino-11-methyl-2-oxo-7-propyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate.
| Compound Name | ethyl 6-[2-[(1Z)-buta-1,3-dienyl]sulfanylacetyl]imino-11-methyl-2-oxo-7-propyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 17390448 |
| Molecular Formula | C24H26N4O4S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | ethyl 6-[2-[(1Z)-buta-1,3-dienyl]sulfanylacetyl]imino-11-methyl-2-oxo-7-propyl-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carboxylate |
| SMILES | C=C/C=C\SCC(=O)/N=c1/c(C(=O)OCC)cc2c(=O)n3cccc(C)c3nc2n1CCC |
| InChI | InChI=1S/C24H26N4O4S/c1-5-8-13-33-15-19(29)25-22-18(24(31)32-7-3)14-17-21(27(22)11-6-2)26-20-16(4)10-9-12-28(20)23(17)30/h5,8-10,12-14H,1,6-7,11,15H2,2-4H3/b13-8-,25-22- |
| InChIKey | DYFMBJOOVMSOMP-BTBHFYAUSA-N |
| XLogP | 3.40 |
| TPSA | 95.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|