About 1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)acetyl]imidazolidin-2-one
1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)acetyl]imidazolidin-2-one (PubChem CID 17390563) has the molecular formula C7H8N4O2S2
and a molecular weight of 244.30 g/mol. Its IUPAC name is 1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)acetyl]imidazolidin-2-one.
Molecular Properties
| Compound Name | 1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)acetyl]imidazolidin-2-one |
| PubChem CID | 17390563 |
| Molecular Formula | C7H8N4O2S2 |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | 1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)acetyl]imidazolidin-2-one |
| SMILES | O=C(CSc1nncs1)N1CCNC1=O |
| InChI | InChI=1S/C7H8N4O2S2/c12-5(11-2-1-8-6(11)13)3-14-7-10-9-4-15-7/h4H,1-3H2,(H,8,13) |
| InChIKey | KXMRJZRJZJAXRI-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)acetyl]imidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)acetyl]imidazolidin-2-one?
The IUPAC name of 1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)acetyl]imidazolidin-2-one (CID 17390563) is 1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)acetyl]imidazolidin-2-one.
What is the SMILES notation for 1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)acetyl]imidazolidin-2-one?
The canonical SMILES for 1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)acetyl]imidazolidin-2-one is O=C(CSc1nncs1)N1CCNC1=O.
What is the InChIKey of 1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)acetyl]imidazolidin-2-one?
The InChIKey is KXMRJZRJZJAXRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4O2S2/c12-5(11-2-1-8-6(11)13)3-14-7-10-9-4-15-7/h4H,1-3H2,(H,8,13).
What are the key properties of 1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)acetyl]imidazolidin-2-one?
1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)acetyl]imidazolidin-2-one has a molecular weight of 244.30 g/mol, XLogP of 0.18, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(1,3,4-thiadiazol-2-ylsulfanyl)acetyl]imidazolidin-2-one is sourced from PubChem (CID 17390563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).