About 6,7-dimethoxy-2-(thiophen-2-ylmethyl)-3,1-benzoxazin-4-one
6,7-dimethoxy-2-(thiophen-2-ylmethyl)-3,1-benzoxazin-4-one (PubChem CID 17390898) has the molecular formula C15H13NO4S
and a molecular weight of 303.34 g/mol. Its IUPAC name is 6,7-dimethoxy-2-(thiophen-2-ylmethyl)-3,1-benzoxazin-4-one.
Molecular Properties
| Compound Name | 6,7-dimethoxy-2-(thiophen-2-ylmethyl)-3,1-benzoxazin-4-one |
| PubChem CID | 17390898 |
| Molecular Formula | C15H13NO4S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 6,7-dimethoxy-2-(thiophen-2-ylmethyl)-3,1-benzoxazin-4-one |
| SMILES | COc1cc2nc(Cc3cccs3)oc(=O)c2cc1OC |
| InChI | InChI=1S/C15H13NO4S/c1-18-12-7-10-11(8-13(12)19-2)16-14(20-15(10)17)6-9-4-3-5-21-9/h3-5,7-8H,6H2,1-2H3 |
| InChIKey | FCFVYDSJEMLSOR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6,7-dimethoxy-2-(thiophen-2-ylmethyl)-3,1-benzoxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethoxy-2-(thiophen-2-ylmethyl)-3,1-benzoxazin-4-one?
The IUPAC name of 6,7-dimethoxy-2-(thiophen-2-ylmethyl)-3,1-benzoxazin-4-one (CID 17390898) is 6,7-dimethoxy-2-(thiophen-2-ylmethyl)-3,1-benzoxazin-4-one.
What is the SMILES notation for 6,7-dimethoxy-2-(thiophen-2-ylmethyl)-3,1-benzoxazin-4-one?
The canonical SMILES for 6,7-dimethoxy-2-(thiophen-2-ylmethyl)-3,1-benzoxazin-4-one is COc1cc2nc(Cc3cccs3)oc(=O)c2cc1OC.
What is the InChIKey of 6,7-dimethoxy-2-(thiophen-2-ylmethyl)-3,1-benzoxazin-4-one?
The InChIKey is FCFVYDSJEMLSOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO4S/c1-18-12-7-10-11(8-13(12)19-2)16-14(20-15(10)17)6-9-4-3-5-21-9/h3-5,7-8H,6H2,1-2H3.
What are the key properties of 6,7-dimethoxy-2-(thiophen-2-ylmethyl)-3,1-benzoxazin-4-one?
6,7-dimethoxy-2-(thiophen-2-ylmethyl)-3,1-benzoxazin-4-one has a molecular weight of 303.34 g/mol, XLogP of 2.86, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethoxy-2-(thiophen-2-ylmethyl)-3,1-benzoxazin-4-one is sourced from PubChem (CID 17390898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).