About 3-(5-cyano-2,4-dimethyl-6-oxo-1H-pyridin-3-yl)-N-propan-2-ylpropanamide
3-(5-cyano-2,4-dimethyl-6-oxo-1H-pyridin-3-yl)-N-propan-2-ylpropanamide (PubChem CID 17392187) has the molecular formula C14H19N3O2
and a molecular weight of 261.32 g/mol. Its IUPAC name is 3-(5-cyano-2,4-dimethyl-6-oxo-1H-pyridin-3-yl)-N-propan-2-ylpropanamide.
Molecular Properties
| Compound Name | 3-(5-cyano-2,4-dimethyl-6-oxo-1H-pyridin-3-yl)-N-propan-2-ylpropanamide |
| PubChem CID | 17392187 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 3-(5-cyano-2,4-dimethyl-6-oxo-1H-pyridin-3-yl)-N-propan-2-ylpropanamide |
| SMILES | Cc1[nH]c(=O)c(C#N)c(C)c1CCC(=O)NC(C)C |
| InChI | InChI=1S/C14H19N3O2/c1-8(2)16-13(18)6-5-11-9(3)12(7-15)14(19)17-10(11)4/h8H,5-6H2,1-4H3,(H,16,18)(H,17,19) |
| InChIKey | DTFQJFWTRXEUCP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(5-cyano-2,4-dimethyl-6-oxo-1H-pyridin-3-yl)-N-propan-2-ylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-cyano-2,4-dimethyl-6-oxo-1H-pyridin-3-yl)-N-propan-2-ylpropanamide?
The IUPAC name of 3-(5-cyano-2,4-dimethyl-6-oxo-1H-pyridin-3-yl)-N-propan-2-ylpropanamide (CID 17392187) is 3-(5-cyano-2,4-dimethyl-6-oxo-1H-pyridin-3-yl)-N-propan-2-ylpropanamide.
What is the SMILES notation for 3-(5-cyano-2,4-dimethyl-6-oxo-1H-pyridin-3-yl)-N-propan-2-ylpropanamide?
The canonical SMILES for 3-(5-cyano-2,4-dimethyl-6-oxo-1H-pyridin-3-yl)-N-propan-2-ylpropanamide is Cc1[nH]c(=O)c(C#N)c(C)c1CCC(=O)NC(C)C.
What is the InChIKey of 3-(5-cyano-2,4-dimethyl-6-oxo-1H-pyridin-3-yl)-N-propan-2-ylpropanamide?
The InChIKey is DTFQJFWTRXEUCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O2/c1-8(2)16-13(18)6-5-11-9(3)12(7-15)14(19)17-10(11)4/h8H,5-6H2,1-4H3,(H,16,18)(H,17,19).
What are the key properties of 3-(5-cyano-2,4-dimethyl-6-oxo-1H-pyridin-3-yl)-N-propan-2-ylpropanamide?
3-(5-cyano-2,4-dimethyl-6-oxo-1H-pyridin-3-yl)-N-propan-2-ylpropanamide has a molecular weight of 261.32 g/mol, XLogP of 1.32, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-cyano-2,4-dimethyl-6-oxo-1H-pyridin-3-yl)-N-propan-2-ylpropanamide is sourced from PubChem (CID 17392187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).