C19H18N6O — CID 17392536
(E)-2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]-3-(2-methoxynaphthalen-1-yl)prop-2-enenitrile (PubChem CID 17392536) has the molecular formula C19H18N6O and a molecular weight of 346.39 g/mol. Its IUPAC name is (E)-2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]-3-(2-methoxynaphthalen-1-yl)prop-2-enenitrile.
| Compound Name | (E)-2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]-3-(2-methoxynaphthalen-1-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 17392536 |
| Molecular Formula | C19H18N6O |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | (E)-2-[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]-3-(2-methoxynaphthalen-1-yl)prop-2-enenitrile |
| SMILES | COc1ccc2ccccc2c1/C=C(\C#N)c1nc(N)nc(N(C)C)n1 |
| InChI | InChI=1S/C19H18N6O/c1-25(2)19-23-17(22-18(21)24-19)13(11-20)10-15-14-7-5-4-6-12(14)8-9-16(15)26-3/h4-10H,1-3H3,(H2,21,22,23,24)/b13-10+ |
| InChIKey | YMCLPPHUNXXXSW-JLHYYAGUSA-N |
| XLogP | 2.75 |
| TPSA | 100.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|