C26H28N4O3S — CID 17393014
7-[[4-[(E)-3-(2-butyl-1-benzofuran-3-yl)prop-2-enoyl]piperazin-1-yl]methyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 17393014) has the molecular formula C26H28N4O3S and a molecular weight of 476.60 g/mol. Its IUPAC name is 7-[[4-[(E)-3-(2-butyl-1-benzofuran-3-yl)prop-2-enoyl]piperazin-1-yl]methyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 7-[[4-[(E)-3-(2-butyl-1-benzofuran-3-yl)prop-2-enoyl]piperazin-1-yl]methyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 17393014 |
| Molecular Formula | C26H28N4O3S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | 7-[[4-[(E)-3-(2-butyl-1-benzofuran-3-yl)prop-2-enoyl]piperazin-1-yl]methyl]-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | CCCCc1oc2ccccc2c1/C=C/C(=O)N1CCN(Cc2cc(=O)n3ccsc3n2)CC1 |
| InChI | InChI=1S/C26H28N4O3S/c1-2-3-7-22-21(20-6-4-5-8-23(20)33-22)9-10-24(31)29-13-11-28(12-14-29)18-19-17-25(32)30-15-16-34-26(30)27-19/h4-6,8-10,15-17H,2-3,7,11-14,18H2,1H3/b10-9+ |
| InChIKey | XOLYQKZKTSPPPO-MDZDMXLPSA-N |
| XLogP | 4.20 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|