About tert-butyl 4-[[4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]methyl]piperazine-1-carboxylate
tert-butyl 4-[[4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]methyl]piperazine-1-carboxylate (PubChem CID 17393059) has the molecular formula C17H30N4O4
and a molecular weight of 354.45 g/mol. Its IUPAC name is tert-butyl 4-[[4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]methyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[[4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]methyl]piperazine-1-carboxylate |
| PubChem CID | 17393059 |
| Molecular Formula | C17H30N4O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | tert-butyl 4-[[4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]methyl]piperazine-1-carboxylate |
| SMILES | CC(C)CC1NC(=O)N(CN2CCN(C(=O)OC(C)(C)C)CC2)C1=O |
| InChI | InChI=1S/C17H30N4O4/c1-12(2)10-13-14(22)21(15(23)18-13)11-19-6-8-20(9-7-19)16(24)25-17(3,4)5/h12-13H,6-11H2,1-5H3,(H,18,23) |
| InChIKey | WFDCKCJCQVBBTE-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-[[4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]methyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[[4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]methyl]piperazine-1-carboxylate?
The IUPAC name of tert-butyl 4-[[4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]methyl]piperazine-1-carboxylate (CID 17393059) is tert-butyl 4-[[4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]methyl]piperazine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[[4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]methyl]piperazine-1-carboxylate?
The canonical SMILES for tert-butyl 4-[[4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]methyl]piperazine-1-carboxylate is CC(C)CC1NC(=O)N(CN2CCN(C(=O)OC(C)(C)C)CC2)C1=O.
What is the InChIKey of tert-butyl 4-[[4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]methyl]piperazine-1-carboxylate?
The InChIKey is WFDCKCJCQVBBTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30N4O4/c1-12(2)10-13-14(22)21(15(23)18-13)11-19-6-8-20(9-7-19)16(24)25-17(3,4)5/h12-13H,6-11H2,1-5H3,(H,18,23).
What are the key properties of tert-butyl 4-[[4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]methyl]piperazine-1-carboxylate?
tert-butyl 4-[[4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]methyl]piperazine-1-carboxylate has a molecular weight of 354.45 g/mol, XLogP of 1.46, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[[4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]methyl]piperazine-1-carboxylate is sourced from PubChem (CID 17393059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).