C20H27NO4S — CID 17393824
N-[3-(3,4-dimethoxyphenyl)propyl]-N,2,5-trimethylbenzenesulfonamide (PubChem CID 17393824) has the molecular formula C20H27NO4S and a molecular weight of 377.51 g/mol. Its IUPAC name is N-[3-(3,4-dimethoxyphenyl)propyl]-N,2,5-trimethylbenzenesulfonamide.
| Compound Name | N-[3-(3,4-dimethoxyphenyl)propyl]-N,2,5-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 17393824 |
| Molecular Formula | C20H27NO4S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-[3-(3,4-dimethoxyphenyl)propyl]-N,2,5-trimethylbenzenesulfonamide |
| SMILES | COc1ccc(CCCN(C)S(=O)(=O)c2cc(C)ccc2C)cc1OC |
| InChI | InChI=1S/C20H27NO4S/c1-15-8-9-16(2)20(13-15)26(22,23)21(3)12-6-7-17-10-11-18(24-4)19(14-17)25-5/h8-11,13-14H,6-7,12H2,1-5H3 |
| InChIKey | PHOBXAKROURURP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |