C15H22N2O2 — CID 17395399
2-acetamido-3-methyl-N-[(2-methylphenyl)methyl]butanamide (PubChem CID 17395399) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-acetamido-3-methyl-N-[(2-methylphenyl)methyl]butanamide.
| Compound Name | 2-acetamido-3-methyl-N-[(2-methylphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 17395399 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 2-acetamido-3-methyl-N-[(2-methylphenyl)methyl]butanamide |
| SMILES | CC(=O)NC(C(=O)NCc1ccccc1C)C(C)C |
| InChI | InChI=1S/C15H22N2O2/c1-10(2)14(17-12(4)18)15(19)16-9-13-8-6-5-7-11(13)3/h5-8,10,14H,9H2,1-4H3,(H,16,19)(H,17,18) |
| InChIKey | ORULXEDXPJETLH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |