C12H14N4OS — CID 17395720
N-benzyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)propanamide (PubChem CID 17395720) has the molecular formula C12H14N4OS and a molecular weight of 262.34 g/mol. Its IUPAC name is N-benzyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)propanamide.
| Compound Name | N-benzyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)propanamide |
|---|---|
| PubChem CID | 17395720 |
| Molecular Formula | C12H14N4OS |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | N-benzyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)propanamide |
| SMILES | CC(Sc1ncn[nH]1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C12H14N4OS/c1-9(18-12-14-8-15-16-12)11(17)13-7-10-5-3-2-4-6-10/h2-6,8-9H,7H2,1H3,(H,13,17)(H,14,15,16) |
| InChIKey | KUKAOLMQYVNJEQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |