C17H20FNO3S — CID 17396022
ethyl 4-fluoro-3-[(3-hydroxypiperidin-1-yl)methyl]-1-benzothiophene-2-carboxylate (PubChem CID 17396022) has the molecular formula C17H20FNO3S and a molecular weight of 337.42 g/mol. Its IUPAC name is ethyl 4-fluoro-3-[(3-hydroxypiperidin-1-yl)methyl]-1-benzothiophene-2-carboxylate.
| Compound Name | ethyl 4-fluoro-3-[(3-hydroxypiperidin-1-yl)methyl]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 17396022 |
| Molecular Formula | C17H20FNO3S |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | ethyl 4-fluoro-3-[(3-hydroxypiperidin-1-yl)methyl]-1-benzothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc2cccc(F)c2c1CN1CCCC(O)C1 |
| InChI | InChI=1S/C17H20FNO3S/c1-2-22-17(21)16-12(10-19-8-4-5-11(20)9-19)15-13(18)6-3-7-14(15)23-16/h3,6-7,11,20H,2,4-5,8-10H2,1H3 |
| InChIKey | QDYOPLPHNNLNKC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |