About methyl 2-benzyl-4,5-dihydro-1,3-thiazole-4-carboxylate
methyl 2-benzyl-4,5-dihydro-1,3-thiazole-4-carboxylate (PubChem CID 17399147) has the molecular formula C12H13NO2S
and a molecular weight of 235.31 g/mol. Its IUPAC name is methyl 2-benzyl-4,5-dihydro-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 2-benzyl-4,5-dihydro-1,3-thiazole-4-carboxylate |
| PubChem CID | 17399147 |
| Molecular Formula | C12H13NO2S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | methyl 2-benzyl-4,5-dihydro-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)C1CSC(Cc2ccccc2)=N1 |
| InChI | InChI=1S/C12H13NO2S/c1-15-12(14)10-8-16-11(13-10)7-9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3 |
| InChIKey | QZYVYPFMHLQSPP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-benzyl-4,5-dihydro-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-benzyl-4,5-dihydro-1,3-thiazole-4-carboxylate?
The IUPAC name of methyl 2-benzyl-4,5-dihydro-1,3-thiazole-4-carboxylate (CID 17399147) is methyl 2-benzyl-4,5-dihydro-1,3-thiazole-4-carboxylate.
What is the SMILES notation for methyl 2-benzyl-4,5-dihydro-1,3-thiazole-4-carboxylate?
The canonical SMILES for methyl 2-benzyl-4,5-dihydro-1,3-thiazole-4-carboxylate is COC(=O)C1CSC(Cc2ccccc2)=N1.
What is the InChIKey of methyl 2-benzyl-4,5-dihydro-1,3-thiazole-4-carboxylate?
The InChIKey is QZYVYPFMHLQSPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2S/c1-15-12(14)10-8-16-11(13-10)7-9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3.
What are the key properties of methyl 2-benzyl-4,5-dihydro-1,3-thiazole-4-carboxylate?
methyl 2-benzyl-4,5-dihydro-1,3-thiazole-4-carboxylate has a molecular weight of 235.31 g/mol, XLogP of 1.92, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-benzyl-4,5-dihydro-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 17399147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).