About 1-(5-phenyl-3,4-dihydropyrazol-2-yl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone
1-(5-phenyl-3,4-dihydropyrazol-2-yl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone (PubChem CID 17399578) has the molecular formula C17H14F3N3OS
and a molecular weight of 365.38 g/mol. Its IUPAC name is 1-(5-phenyl-3,4-dihydropyrazol-2-yl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone.
Molecular Properties
| Compound Name | 1-(5-phenyl-3,4-dihydropyrazol-2-yl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone |
| PubChem CID | 17399578 |
| Molecular Formula | C17H14F3N3OS |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 1-(5-phenyl-3,4-dihydropyrazol-2-yl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone |
| SMILES | O=C(CSc1ccc(C(F)(F)F)cn1)N1CCC(c2ccccc2)=N1 |
| InChI | InChI=1S/C17H14F3N3OS/c18-17(19,20)13-6-7-15(21-10-13)25-11-16(24)23-9-8-14(22-23)12-4-2-1-3-5-12/h1-7,10H,8-9,11H2 |
| InChIKey | NAGBCHLWEPZPSV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(5-phenyl-3,4-dihydropyrazol-2-yl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-phenyl-3,4-dihydropyrazol-2-yl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone?
The IUPAC name of 1-(5-phenyl-3,4-dihydropyrazol-2-yl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone (CID 17399578) is 1-(5-phenyl-3,4-dihydropyrazol-2-yl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone.
What is the SMILES notation for 1-(5-phenyl-3,4-dihydropyrazol-2-yl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone?
The canonical SMILES for 1-(5-phenyl-3,4-dihydropyrazol-2-yl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone is O=C(CSc1ccc(C(F)(F)F)cn1)N1CCC(c2ccccc2)=N1.
What is the InChIKey of 1-(5-phenyl-3,4-dihydropyrazol-2-yl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone?
The InChIKey is NAGBCHLWEPZPSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14F3N3OS/c18-17(19,20)13-6-7-15(21-10-13)25-11-16(24)23-9-8-14(22-23)12-4-2-1-3-5-12/h1-7,10H,8-9,11H2.
What are the key properties of 1-(5-phenyl-3,4-dihydropyrazol-2-yl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone?
1-(5-phenyl-3,4-dihydropyrazol-2-yl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone has a molecular weight of 365.38 g/mol, XLogP of 3.83, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-phenyl-3,4-dihydropyrazol-2-yl)-2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethanone is sourced from PubChem (CID 17399578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).