C14H19BF2O2 — CID 174000542
2-(4,7-difluoro-6-methylidenecyclohepta-1,3-dien-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 174000542) has the molecular formula C14H19BF2O2 and a molecular weight of 268.11 g/mol. Its IUPAC name is 2-(4,7-difluoro-6-methylidenecyclohepta-1,3-dien-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(4,7-difluoro-6-methylidenecyclohepta-1,3-dien-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 174000542 |
| Molecular Formula | C14H19BF2O2 |
| Molecular Weight | 268.11 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 2-(4,7-difluoro-6-methylidenecyclohepta-1,3-dien-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=C1CC(F)=CC=C(B2OC(C)(C)C(C)(C)O2)C1F |
| InChI | InChI=1S/C14H19BF2O2/c1-9-8-10(16)6-7-11(12(9)17)15-18-13(2,3)14(4,5)19-15/h6-7,12H,1,8H2,2-5H3 |
| InChIKey | KDAFCYKSIZKMJD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.11 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|