C28H30ClN6O3Si — CID 174000894
CID 174000894 (PubChem CID 174000894) has the molecular formula C28H30ClN6O3Si and a molecular weight of 562.13 g/mol.
| Compound Name | CID 174000894 |
|---|---|
| PubChem CID | 174000894 |
| Molecular Formula | C28H30ClN6O3Si |
| Molecular Weight | 562.13 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | — |
| SMILES | N#Cc1ccc(NC[Si]2CCO2)c(NC(=O)CN2CCC(Oc3ccnc(Cc4ccc(Cl)cc4)n3)CC2)c1 |
| InChI | InChI=1S/C28H30ClN6O3Si/c29-22-4-1-20(2-5-22)16-26-31-10-7-28(34-26)38-23-8-11-35(12-9-23)18-27(36)33-25-15-21(17-30)3-6-24(25)32-19-39-14-13-37-39/h1-7,10,15,23,32H,8-9,11-14,16,18-19H2,(H,33,36) |
| InChIKey | ZEGXKTSBCLOZDZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 112.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.13 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|